C11H18N4O2S — CID 62798939
N-[2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]ethyl]-2-methylpropanamide (PubChem CID 62798939) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is N-[2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 62798939 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-[2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]ethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCNC(=O)Cc1csc(N)n1 |
| InChI | InChI=1S/C11H18N4O2S/c1-7(2)10(17)14-4-3-13-9(16)5-8-6-18-11(12)15-8/h6-7H,3-5H2,1-2H3,(H2,12,15)(H,13,16)(H,14,17) |
| InChIKey | ROYSHZPRJPOQLA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|