C6H8N2OS — CID 22977217
1-(2-amino-1,3-thiazol-4-yl)propan-2-one (PubChem CID 22977217) has the molecular formula C6H8N2OS and a molecular weight of 156.21 g/mol. Its IUPAC name is 1-(2-amino-1,3-thiazol-4-yl)propan-2-one.
| Compound Name | 1-(2-amino-1,3-thiazol-4-yl)propan-2-one |
|---|---|
| PubChem CID | 22977217 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 1-(2-amino-1,3-thiazol-4-yl)propan-2-one |
| SMILES | CC(=O)Cc1csc(N)n1 |
| InChI | InChI=1S/C6H8N2OS/c1-4(9)2-5-3-10-6(7)8-5/h3H,2H2,1H3,(H2,7,8) |
| InChIKey | MGTFCPWYTKWULX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |