C12H19ClN2OS — CID 62199892
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-hexan-2-ylacetamide (PubChem CID 62199892) has the molecular formula C12H19ClN2OS and a molecular weight of 274.82 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-hexan-2-ylacetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-hexan-2-ylacetamide |
|---|---|
| PubChem CID | 62199892 |
| Molecular Formula | C12H19ClN2OS |
| Molecular Weight | 274.82 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-hexan-2-ylacetamide |
| SMILES | CCCCC(C)NC(=O)Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C12H19ClN2OS/c1-3-4-5-9(2)14-11(16)6-12-15-10(7-13)8-17-12/h8-9H,3-7H2,1-2H3,(H,14,16) |
| InChIKey | FIFYWTCMQGGDNJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.82 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|