C12H10ClIN2OS — CID 43319978
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(4-iodophenyl)acetamide (PubChem CID 43319978) has the molecular formula C12H10ClIN2OS and a molecular weight of 392.65 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 43319978 |
| Molecular Formula | C12H10ClIN2OS |
| Molecular Weight | 392.65 g/mol |
| Exact Mass | 391.92 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(4-iodophenyl)acetamide |
| SMILES | O=C(Cc1nc(CCl)cs1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C12H10ClIN2OS/c13-6-10-7-18-12(16-10)5-11(17)15-9-3-1-8(14)2-4-9/h1-4,7H,5-6H2,(H,15,17) |
| InChIKey | YQYJBHIITHYBGG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.65 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|