C13H12BrClN2O2S — CID 82860270
N-(4-bromo-3-methoxyphenyl)-2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 82860270) has the molecular formula C13H12BrClN2O2S and a molecular weight of 375.68 g/mol. Its IUPAC name is N-(4-bromo-3-methoxyphenyl)-2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-(4-bromo-3-methoxyphenyl)-2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 82860270 |
| Molecular Formula | C13H12BrClN2O2S |
| Molecular Weight | 375.68 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | N-(4-bromo-3-methoxyphenyl)-2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1cc(NC(=O)Cc2nc(CCl)cs2)ccc1Br |
| InChI | InChI=1S/C13H12BrClN2O2S/c1-19-11-4-8(2-3-10(11)14)16-12(18)5-13-17-9(6-15)7-20-13/h2-4,7H,5-6H2,1H3,(H,16,18) |
| InChIKey | ZHDLNRPHDRDXSL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.68 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|