C12H8Br3ClN2OS — CID 43319976
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2,4,6-tribromophenyl)acetamide (PubChem CID 43319976) has the molecular formula C12H8Br3ClN2OS and a molecular weight of 503.44 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2,4,6-tribromophenyl)acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2,4,6-tribromophenyl)acetamide |
|---|---|
| PubChem CID | 43319976 |
| Molecular Formula | C12H8Br3ClN2OS |
| Molecular Weight | 503.44 g/mol |
| Exact Mass | 499.76 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2,4,6-tribromophenyl)acetamide |
| SMILES | O=C(Cc1nc(CCl)cs1)Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C12H8Br3ClN2OS/c13-6-1-8(14)12(9(15)2-6)18-10(19)3-11-17-7(4-16)5-20-11/h1-2,5H,3-4H2,(H,18,19) |
| InChIKey | NGELUVBFURNNIF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|