C9H8ClN5OS — CID 114388829
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(1,2,4-triazin-3-yl)acetamide (PubChem CID 114388829) has the molecular formula C9H8ClN5OS and a molecular weight of 269.72 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(1,2,4-triazin-3-yl)acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(1,2,4-triazin-3-yl)acetamide |
|---|---|
| PubChem CID | 114388829 |
| Molecular Formula | C9H8ClN5OS |
| Molecular Weight | 269.72 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(1,2,4-triazin-3-yl)acetamide |
| SMILES | O=C(Cc1nc(CCl)cs1)Nc1nccnn1 |
| InChI | InChI=1S/C9H8ClN5OS/c10-4-6-5-17-8(13-6)3-7(16)14-9-11-1-2-12-15-9/h1-2,5H,3-4H2,(H,11,14,15,16) |
| InChIKey | HDKIWKRRORGWGW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.72 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|