C12H9ClF2N2OS — CID 43320053
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2,5-difluorophenyl)acetamide (PubChem CID 43320053) has the molecular formula C12H9ClF2N2OS and a molecular weight of 302.73 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2,5-difluorophenyl)acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2,5-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 43320053 |
| Molecular Formula | C12H9ClF2N2OS |
| Molecular Weight | 302.73 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2,5-difluorophenyl)acetamide |
| SMILES | O=C(Cc1nc(CCl)cs1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C12H9ClF2N2OS/c13-5-8-6-19-12(16-8)4-11(18)17-10-3-7(14)1-2-9(10)15/h1-3,6H,4-5H2,(H,17,18) |
| InChIKey | MGCURQRKFKDUPH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.73 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|