C12H11ClN2O3S2 — CID 43137996
methyl 3-[[2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetyl]amino]thiophene-2-carboxylate (PubChem CID 43137996) has the molecular formula C12H11ClN2O3S2 and a molecular weight of 330.82 g/mol. Its IUPAC name is methyl 3-[[2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 43137996 |
| Molecular Formula | C12H11ClN2O3S2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | methyl 3-[[2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C12H11ClN2O3S2/c1-18-12(17)11-8(2-3-19-11)15-9(16)4-10-14-7(5-13)6-20-10/h2-3,6H,4-5H2,1H3,(H,15,16) |
| InChIKey | FGDFFOODFHQCHV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|