C12H9BrClFN2OS — CID 107629357
N-(2-bromo-5-fluorophenyl)-2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 107629357) has the molecular formula C12H9BrClFN2OS and a molecular weight of 363.64 g/mol. Its IUPAC name is N-(2-bromo-5-fluorophenyl)-2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-(2-bromo-5-fluorophenyl)-2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 107629357 |
| Molecular Formula | C12H9BrClFN2OS |
| Molecular Weight | 363.64 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | N-(2-bromo-5-fluorophenyl)-2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(Cc1nc(CCl)cs1)Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C12H9BrClFN2OS/c13-9-2-1-7(15)3-10(9)17-11(18)4-12-16-8(5-14)6-19-12/h1-3,6H,4-5H2,(H,17,18) |
| InChIKey | AEYJCPAPAMXYLF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.64 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|