C13H13ClN2O3S2 — CID 43320120
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(4-methylsulfonylphenyl)acetamide (PubChem CID 43320120) has the molecular formula C13H13ClN2O3S2 and a molecular weight of 344.85 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(4-methylsulfonylphenyl)acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 43320120 |
| Molecular Formula | C13H13ClN2O3S2 |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(4-methylsulfonylphenyl)acetamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)Cc2nc(CCl)cs2)cc1 |
| InChI | InChI=1S/C13H13ClN2O3S2/c1-21(18,19)11-4-2-9(3-5-11)15-12(17)6-13-16-10(7-14)8-20-13/h2-5,8H,6-7H2,1H3,(H,15,17) |
| InChIKey | BCMPEXGDQCEBKW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|