C13H21ClN2OS — CID 65042316
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(3-ethylpentan-3-yl)acetamide (PubChem CID 65042316) has the molecular formula C13H21ClN2OS and a molecular weight of 288.84 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(3-ethylpentan-3-yl)acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(3-ethylpentan-3-yl)acetamide |
|---|---|
| PubChem CID | 65042316 |
| Molecular Formula | C13H21ClN2OS |
| Molecular Weight | 288.84 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(3-ethylpentan-3-yl)acetamide |
| SMILES | CCC(CC)(CC)NC(=O)Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C13H21ClN2OS/c1-4-13(5-2,6-3)16-11(17)7-12-15-10(8-14)9-18-12/h9H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | HXLCUCQOGSRFAP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.84 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|