C10H9NOS2 — CID 116966409
1-(4-thiophen-2-yl-1,3-thiazol-2-yl)propan-2-one (PubChem CID 116966409) has the molecular formula C10H9NOS2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-(4-thiophen-2-yl-1,3-thiazol-2-yl)propan-2-one.
| Compound Name | 1-(4-thiophen-2-yl-1,3-thiazol-2-yl)propan-2-one |
|---|---|
| PubChem CID | 116966409 |
| Molecular Formula | C10H9NOS2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | 1-(4-thiophen-2-yl-1,3-thiazol-2-yl)propan-2-one |
| SMILES | CC(=O)Cc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C10H9NOS2/c1-7(12)5-10-11-8(6-14-10)9-3-2-4-13-9/h2-4,6H,5H2,1H3 |
| InChIKey | ZSDPEMIMLIJYIQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |