C10H11BrN2S2 — CID 62652862
1-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]propan-2-amine (PubChem CID 62652862) has the molecular formula C10H11BrN2S2 and a molecular weight of 303.25 g/mol. Its IUPAC name is 1-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]propan-2-amine.
| Compound Name | 1-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]propan-2-amine |
|---|---|
| PubChem CID | 62652862 |
| Molecular Formula | C10H11BrN2S2 |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 301.95 |
| IUPAC Name | 1-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]propan-2-amine |
| SMILES | CC(N)Cc1nc(-c2ccc(Br)s2)cs1 |
| InChI | InChI=1S/C10H11BrN2S2/c1-6(12)4-10-13-7(5-14-10)8-2-3-9(11)15-8/h2-3,5-6H,4,12H2,1H3 |
| InChIKey | UOCLSZUAMGMZGZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |