C11H13N3S — CID 62653588
1-(4-pyridin-4-yl-1,3-thiazol-2-yl)propan-2-amine (PubChem CID 62653588) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 1-(4-pyridin-4-yl-1,3-thiazol-2-yl)propan-2-amine.
| Compound Name | 1-(4-pyridin-4-yl-1,3-thiazol-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 62653588 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 1-(4-pyridin-4-yl-1,3-thiazol-2-yl)propan-2-amine |
| SMILES | CC(N)Cc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C11H13N3S/c1-8(12)6-11-14-10(7-15-11)9-2-4-13-5-3-9/h2-5,7-8H,6,12H2,1H3 |
| InChIKey | KCYRQMLOZHEPHA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |