C9H10N4S — CID 116970238
(4-pyridin-4-yl-1,3-thiazol-2-yl)methylhydrazine (PubChem CID 116970238) has the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. Its IUPAC name is (4-pyridin-4-yl-1,3-thiazol-2-yl)methylhydrazine.
| Compound Name | (4-pyridin-4-yl-1,3-thiazol-2-yl)methylhydrazine |
|---|---|
| PubChem CID | 116970238 |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | (4-pyridin-4-yl-1,3-thiazol-2-yl)methylhydrazine |
| SMILES | NNCc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C9H10N4S/c10-12-5-9-13-8(6-14-9)7-1-3-11-4-2-7/h1-4,6,12H,5,10H2 |
| InChIKey | ISFFTPAYSLQHJK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|