C12H15N3O2S — CID 116970172
[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]methylhydrazine (PubChem CID 116970172) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is [4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]methylhydrazine.
| Compound Name | [4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]methylhydrazine |
|---|---|
| PubChem CID | 116970172 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | [4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]methylhydrazine |
| SMILES | COc1ccc(-c2csc(CNN)n2)cc1OC |
| InChI | InChI=1S/C12H15N3O2S/c1-16-10-4-3-8(5-11(10)17-2)9-7-18-12(15-9)6-14-13/h3-5,7,14H,6,13H2,1-2H3 |
| InChIKey | ZMCBFVRSOKNSJG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|