C18H18N2O4S2 — CID 60615860
4-[2-[(3,4-dimethoxyphenyl)methyl]-1,3-thiazol-4-yl]benzenesulfonamide (PubChem CID 60615860) has the molecular formula C18H18N2O4S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 4-[2-[(3,4-dimethoxyphenyl)methyl]-1,3-thiazol-4-yl]benzenesulfonamide.
| Compound Name | 4-[2-[(3,4-dimethoxyphenyl)methyl]-1,3-thiazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 60615860 |
| Molecular Formula | C18H18N2O4S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 4-[2-[(3,4-dimethoxyphenyl)methyl]-1,3-thiazol-4-yl]benzenesulfonamide |
| SMILES | COc1ccc(Cc2nc(-c3ccc(S(N)(=O)=O)cc3)cs2)cc1OC |
| InChI | InChI=1S/C18H18N2O4S2/c1-23-16-8-3-12(9-17(16)24-2)10-18-20-15(11-25-18)13-4-6-14(7-5-13)26(19,21)22/h3-9,11H,10H2,1-2H3,(H2,19,21,22) |
| InChIKey | XVNYQLRMPHXJFH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |