C13H14ClNO2S — CID 60863894
4-(chloromethyl)-2-[(3,4-dimethoxyphenyl)methyl]-1,3-thiazole (PubChem CID 60863894) has the molecular formula C13H14ClNO2S and a molecular weight of 283.78 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[(3,4-dimethoxyphenyl)methyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[(3,4-dimethoxyphenyl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 60863894 |
| Molecular Formula | C13H14ClNO2S |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 4-(chloromethyl)-2-[(3,4-dimethoxyphenyl)methyl]-1,3-thiazole |
| SMILES | COc1ccc(Cc2nc(CCl)cs2)cc1OC |
| InChI | InChI=1S/C13H14ClNO2S/c1-16-11-4-3-9(5-12(11)17-2)6-13-15-10(7-14)8-18-13/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | CWLONKXXVNXRFL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|