C11H11ClN2O2S — CID 46318449
5-chloro-3-[(3,4-dimethoxyphenyl)methyl]-1,2,4-thiadiazole (PubChem CID 46318449) has the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. Its IUPAC name is 5-chloro-3-[(3,4-dimethoxyphenyl)methyl]-1,2,4-thiadiazole.
| Compound Name | 5-chloro-3-[(3,4-dimethoxyphenyl)methyl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 46318449 |
| Molecular Formula | C11H11ClN2O2S |
| Molecular Weight | 270.74 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 5-chloro-3-[(3,4-dimethoxyphenyl)methyl]-1,2,4-thiadiazole |
| SMILES | COc1ccc(Cc2nsc(Cl)n2)cc1OC |
| InChI | InChI=1S/C11H11ClN2O2S/c1-15-8-4-3-7(5-9(8)16-2)6-10-13-11(12)17-14-10/h3-5H,6H2,1-2H3 |
| InChIKey | UGRIPVJQHKCTFL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.74 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |