C13H13ClN2O2 — CID 60864984
4-chloro-2-[(3,4-dimethoxyphenyl)methyl]pyrimidine (PubChem CID 60864984) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is 4-chloro-2-[(3,4-dimethoxyphenyl)methyl]pyrimidine.
| Compound Name | 4-chloro-2-[(3,4-dimethoxyphenyl)methyl]pyrimidine |
|---|---|
| PubChem CID | 60864984 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 4-chloro-2-[(3,4-dimethoxyphenyl)methyl]pyrimidine |
| SMILES | COc1ccc(Cc2nccc(Cl)n2)cc1OC |
| InChI | InChI=1S/C13H13ClN2O2/c1-17-10-4-3-9(7-11(10)18-2)8-13-15-6-5-12(14)16-13/h3-7H,8H2,1-2H3 |
| InChIKey | HMOAEMXTOKZZTF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |