C15H17ClN2O3 — CID 82169576
4-chloro-2-[(3,4-dimethoxyphenyl)methyl]-6-ethoxypyrimidine (PubChem CID 82169576) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.77 g/mol. Its IUPAC name is 4-chloro-2-[(3,4-dimethoxyphenyl)methyl]-6-ethoxypyrimidine.
| Compound Name | 4-chloro-2-[(3,4-dimethoxyphenyl)methyl]-6-ethoxypyrimidine |
|---|---|
| PubChem CID | 82169576 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4-chloro-2-[(3,4-dimethoxyphenyl)methyl]-6-ethoxypyrimidine |
| SMILES | CCOc1cc(Cl)nc(Cc2ccc(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C15H17ClN2O3/c1-4-21-15-9-13(16)17-14(18-15)8-10-5-6-11(19-2)12(7-10)20-3/h5-7,9H,4,8H2,1-3H3 |
| InChIKey | CXXPTRHSUAHQEY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |