C13H12ClIN2O2 — CID 66292248
4-chloro-2-[(3,4-dimethoxyphenyl)methyl]-5-iodopyrimidine (PubChem CID 66292248) has the molecular formula C13H12ClIN2O2 and a molecular weight of 390.61 g/mol. Its IUPAC name is 4-chloro-2-[(3,4-dimethoxyphenyl)methyl]-5-iodopyrimidine.
| Compound Name | 4-chloro-2-[(3,4-dimethoxyphenyl)methyl]-5-iodopyrimidine |
|---|---|
| PubChem CID | 66292248 |
| Molecular Formula | C13H12ClIN2O2 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 4-chloro-2-[(3,4-dimethoxyphenyl)methyl]-5-iodopyrimidine |
| SMILES | COc1ccc(Cc2ncc(I)c(Cl)n2)cc1OC |
| InChI | InChI=1S/C13H12ClIN2O2/c1-18-10-4-3-8(5-11(10)19-2)6-12-16-7-9(15)13(14)17-12/h3-5,7H,6H2,1-2H3 |
| InChIKey | FIVIBFMLQWMYRW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|