C23H26N2O3S — CID 31264374
N-[3-[4-[2-[(3,4-dimethoxyphenyl)methyl]-1,3-thiazol-4-yl]phenyl]propyl]acetamide (PubChem CID 31264374) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is N-[3-[4-[2-[(3,4-dimethoxyphenyl)methyl]-1,3-thiazol-4-yl]phenyl]propyl]acetamide.
| Compound Name | N-[3-[4-[2-[(3,4-dimethoxyphenyl)methyl]-1,3-thiazol-4-yl]phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 31264374 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N-[3-[4-[2-[(3,4-dimethoxyphenyl)methyl]-1,3-thiazol-4-yl]phenyl]propyl]acetamide |
| SMILES | COc1ccc(Cc2nc(-c3ccc(CCCNC(C)=O)cc3)cs2)cc1OC |
| InChI | InChI=1S/C23H26N2O3S/c1-16(26)24-12-4-5-17-6-9-19(10-7-17)20-15-29-23(25-20)14-18-8-11-21(27-2)22(13-18)28-3/h6-11,13,15H,4-5,12,14H2,1-3H3,(H,24,26) |
| InChIKey | KETKZULMRBIDEP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|