C22H22N4O3S — CID 112773146
4-N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]benzene-1,4-dicarboxamide (PubChem CID 112773146) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is 4-N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 112773146 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 4-N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]benzene-1,4-dicarboxamide |
| SMILES | CC(=O)NCCCc1ccc(-c2csc(NC(=O)c3ccc(C(N)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C22H22N4O3S/c1-14(27)24-12-2-3-15-4-6-16(7-5-15)19-13-30-22(25-19)26-21(29)18-10-8-17(9-11-18)20(23)28/h4-11,13H,2-3,12H2,1H3,(H2,23,28)(H,24,27)(H,25,26,29) |
| InChIKey | GOJHJTNUZHJEPU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|