C19H27ClN4O3S — CID 120587262
N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-4-amino-3-methoxybutanamide;hydrochloride (PubChem CID 120587262) has the molecular formula C19H27ClN4O3S and a molecular weight of 426.97 g/mol. Its IUPAC name is N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-4-amino-3-methoxybutanamide;hydrochloride.
| Compound Name | N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-4-amino-3-methoxybutanamide;hydrochloride |
|---|---|
| PubChem CID | 120587262 |
| Molecular Formula | C19H27ClN4O3S |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-4-amino-3-methoxybutanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)Nc1nc(-c2ccc(CCCNC(C)=O)cc2)cs1.Cl |
| InChI | InChI=1S/C19H26N4O3S.ClH/c1-13(24)21-9-3-4-14-5-7-15(8-6-14)17-12-27-19(22-17)23-18(25)10-16(11-20)26-2;/h5-8,12,16H,3-4,9-11,20H2,1-2H3,(H,21,24)(H,22,23,25);1H |
| InChIKey | OXEONJXNWZUHSW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|