C22H23N3O3S — CID 27993083
N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-2-methoxybenzamide (PubChem CID 27993083) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-2-methoxybenzamide.
| Compound Name | N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 27993083 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1nc(-c2ccc(CCCNC(C)=O)cc2)cs1 |
| InChI | InChI=1S/C22H23N3O3S/c1-15(26)23-13-5-6-16-9-11-17(12-10-16)19-14-29-22(24-19)25-21(27)18-7-3-4-8-20(18)28-2/h3-4,7-12,14H,5-6,13H2,1-2H3,(H,23,26)(H,24,25,27) |
| InChIKey | NENYMEUEBJSRHW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|