C28H27N3O3S — CID 35888051
N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-2-(phenoxymethyl)benzamide (PubChem CID 35888051) has the molecular formula C28H27N3O3S and a molecular weight of 485.61 g/mol. Its IUPAC name is N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-2-(phenoxymethyl)benzamide.
| Compound Name | N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-2-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 35888051 |
| Molecular Formula | C28H27N3O3S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-2-(phenoxymethyl)benzamide |
| SMILES | CC(=O)NCCCc1ccc(-c2csc(NC(=O)c3ccccc3COc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C28H27N3O3S/c1-20(32)29-17-7-8-21-13-15-22(16-14-21)26-19-35-28(30-26)31-27(33)25-12-6-5-9-23(25)18-34-24-10-3-2-4-11-24/h2-6,9-16,19H,7-8,17-18H2,1H3,(H,29,32)(H,30,31,33) |
| InChIKey | DVZICODEQKDBFV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|