C16H20N2O4S — CID 149016806
3-[2-[2-(3,4-dimethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-N-hydroxypropanamide (PubChem CID 149016806) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 3-[2-[2-(3,4-dimethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-N-hydroxypropanamide.
| Compound Name | 3-[2-[2-(3,4-dimethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 149016806 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-[2-[2-(3,4-dimethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-N-hydroxypropanamide |
| SMILES | COc1ccc(CCc2nc(CCC(=O)NO)cs2)cc1OC |
| InChI | InChI=1S/C16H20N2O4S/c1-21-13-6-3-11(9-14(13)22-2)4-8-16-17-12(10-23-16)5-7-15(19)18-20/h3,6,9-10,20H,4-5,7-8H2,1-2H3,(H,18,19) |
| InChIKey | QCRSLSTWSPYKAJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|