C18H17NO4S2 — CID 20658521
4-[2-(3,4-dimethoxyphenyl)thiophen-3-yl]benzenesulfonamide (PubChem CID 20658521) has the molecular formula C18H17NO4S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxyphenyl)thiophen-3-yl]benzenesulfonamide.
| Compound Name | 4-[2-(3,4-dimethoxyphenyl)thiophen-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 20658521 |
| Molecular Formula | C18H17NO4S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 4-[2-(3,4-dimethoxyphenyl)thiophen-3-yl]benzenesulfonamide |
| SMILES | COc1ccc(-c2sccc2-c2ccc(S(N)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C18H17NO4S2/c1-22-16-8-5-13(11-17(16)23-2)18-15(9-10-24-18)12-3-6-14(7-4-12)25(19,20)21/h3-11H,1-2H3,(H2,19,20,21) |
| InChIKey | UMHWSXQNFAKZTC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |