C16H20O2S — CID 25132177
3-butyl-2-(3,4-dimethoxyphenyl)thiophene (PubChem CID 25132177) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is 3-butyl-2-(3,4-dimethoxyphenyl)thiophene.
| Compound Name | 3-butyl-2-(3,4-dimethoxyphenyl)thiophene |
|---|---|
| PubChem CID | 25132177 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3-butyl-2-(3,4-dimethoxyphenyl)thiophene |
| SMILES | CCCCc1ccsc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H20O2S/c1-4-5-6-12-9-10-19-16(12)13-7-8-14(17-2)15(11-13)18-3/h7-11H,4-6H2,1-3H3 |
| InChIKey | NAOHELUCQFUWKT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |