C21H28O4 — CID 178159435
2-(3,4-dimethoxyphenyl)-1,3-dimethoxy-5-pentylbenzene (PubChem CID 178159435) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1,3-dimethoxy-5-pentylbenzene.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1,3-dimethoxy-5-pentylbenzene |
|---|---|
| PubChem CID | 178159435 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1,3-dimethoxy-5-pentylbenzene |
| SMILES | CCCCCc1cc(OC)c(-c2ccc(OC)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C21H28O4/c1-6-7-8-9-15-12-19(24-4)21(20(13-15)25-5)16-10-11-17(22-2)18(14-16)23-3/h10-14H,6-9H2,1-5H3 |
| InChIKey | ZROAFCRKKHIVKJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|