C23H32O3 — CID 171600725
2-[2-(2,6-dimethoxy-4-pentylphenyl)-4-methylphenyl](1,3-13C2)propan-2-ol (PubChem CID 171600725) has the molecular formula C23H32O3 and a molecular weight of 358.49 g/mol. Its IUPAC name is 2-[2-(2,6-dimethoxy-4-pentylphenyl)-4-methylphenyl](1,3-13C2)propan-2-ol.
| Compound Name | 2-[2-(2,6-dimethoxy-4-pentylphenyl)-4-methylphenyl](1,3-13C2)propan-2-ol |
|---|---|
| PubChem CID | 171600725 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 2-[2-(2,6-dimethoxy-4-pentylphenyl)-4-methylphenyl](1,3-13C2)propan-2-ol |
| SMILES | CCCCCc1cc(OC)c(-c2cc(C)ccc2C([13CH3])([13CH3])O)c(OC)c1 |
| InChI | InChI=1S/C23H32O3/c1-7-8-9-10-17-14-20(25-5)22(21(15-17)26-6)18-13-16(2)11-12-19(18)23(3,4)24/h11-15,24H,7-10H2,1-6H3/i3+1,4+1 |
| InChIKey | VPJMSMVPBXFWPD-CQDYUVAPSA-N |
| XLogP | 5.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|