C20H20O5S — CID 44814730
2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol (PubChem CID 44814730) has the molecular formula C20H20O5S and a molecular weight of 372.44 g/mol. Its IUPAC name is 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol.
| Compound Name | 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol |
|---|---|
| PubChem CID | 44814730 |
| Molecular Formula | C20H20O5S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol |
| SMILES | COc1ccc(-c2ccsc2-c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C20H20O5S/c1-22-16-6-5-12(9-15(16)21)14-7-8-26-20(14)13-10-17(23-2)19(25-4)18(11-13)24-3/h5-11,21H,1-4H3 |
| InChIKey | WJTNCSCARJATOW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |