About 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol
2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol (PubChem CID 44814730) has the molecular formula C20H20O5S
and a molecular weight of 372.44 g/mol. Its IUPAC name is 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol.
Molecular Properties
| Compound Name | 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol |
| PubChem CID | 44814730 |
| Molecular Formula | C20H20O5S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol |
| SMILES | COc1ccc(-c2ccsc2-c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C20H20O5S/c1-22-16-6-5-12(9-15(16)21)14-7-8-26-20(14)13-10-17(23-2)19(25-4)18(11-13)24-3/h5-11,21H,1-4H3 |
| InChIKey | WJTNCSCARJATOW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol?
The IUPAC name of 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol (CID 44814730) is 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol.
What is the SMILES notation for 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol?
The canonical SMILES for 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol is COc1ccc(-c2ccsc2-c2cc(OC)c(OC)c(OC)c2)cc1O.
What is the InChIKey of 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol?
The InChIKey is WJTNCSCARJATOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O5S/c1-22-16-6-5-12(9-15(16)21)14-7-8-26-20(14)13-10-17(23-2)19(25-4)18(11-13)24-3/h5-11,21H,1-4H3.
What are the key properties of 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol?
2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol has a molecular weight of 372.44 g/mol, XLogP of 4.82, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)thiophen-3-yl]phenol is sourced from PubChem (CID 44814730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).