C18H17NO5S — CID 18707352
4-[2-(3,4,5-trimethoxyphenyl)-1,3-thiazol-4-yl]benzene-1,2-diol (PubChem CID 18707352) has the molecular formula C18H17NO5S and a molecular weight of 359.40 g/mol. Its IUPAC name is 4-[2-(3,4,5-trimethoxyphenyl)-1,3-thiazol-4-yl]benzene-1,2-diol.
| Compound Name | 4-[2-(3,4,5-trimethoxyphenyl)-1,3-thiazol-4-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 18707352 |
| Molecular Formula | C18H17NO5S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 4-[2-(3,4,5-trimethoxyphenyl)-1,3-thiazol-4-yl]benzene-1,2-diol |
| SMILES | COc1cc(-c2nc(-c3ccc(O)c(O)c3)cs2)cc(OC)c1OC |
| InChI | InChI=1S/C18H17NO5S/c1-22-15-7-11(8-16(23-2)17(15)24-3)18-19-12(9-25-18)10-4-5-13(20)14(21)6-10/h4-9,20-21H,1-3H3 |
| InChIKey | HMGSNIUBMPEAOS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|