C13H9NO3S — CID 25468910
4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol (PubChem CID 25468910) has the molecular formula C13H9NO3S and a molecular weight of 259.29 g/mol. Its IUPAC name is 4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol.
| Compound Name | 4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 25468910 |
| Molecular Formula | C13H9NO3S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol |
| SMILES | Oc1ccc(-c2csc(-c3ccco3)n2)cc1O |
| InChI | InChI=1S/C13H9NO3S/c15-10-4-3-8(6-11(10)16)9-7-18-13(14-9)12-2-1-5-17-12/h1-7,15-16H |
| InChIKey | GIXRNGYJYTVKCU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|