About 4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol
4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol (PubChem CID 25468910) has the molecular formula C13H9NO3S
and a molecular weight of 259.29 g/mol. Its IUPAC name is 4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol.
Molecular Properties
| Compound Name | 4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol |
| PubChem CID | 25468910 |
| Molecular Formula | C13H9NO3S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol |
| SMILES | Oc1ccc(-c2csc(-c3ccco3)n2)cc1O |
| InChI | InChI=1S/C13H9NO3S/c15-10-4-3-8(6-11(10)16)9-7-18-13(14-9)12-2-1-5-17-12/h1-7,15-16H |
| InChIKey | GIXRNGYJYTVKCU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol?
The IUPAC name of 4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol (CID 25468910) is 4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol.
What is the SMILES notation for 4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol?
The canonical SMILES for 4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol is Oc1ccc(-c2csc(-c3ccco3)n2)cc1O.
What is the InChIKey of 4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol?
The InChIKey is GIXRNGYJYTVKCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3S/c15-10-4-3-8(6-11(10)16)9-7-18-13(14-9)12-2-1-5-17-12/h1-7,15-16H.
What are the key properties of 4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol?
4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol has a molecular weight of 259.29 g/mol, XLogP of 3.48, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(furan-2-yl)-1,3-thiazol-4-yl]benzene-1,2-diol is sourced from PubChem (CID 25468910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).