C15H9NO2S — CID 32500831
4-(1-benzofuran-2-yl)-2-(furan-2-yl)-1,3-thiazole (PubChem CID 32500831) has the molecular formula C15H9NO2S and a molecular weight of 267.31 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-2-(furan-2-yl)-1,3-thiazole.
| Compound Name | 4-(1-benzofuran-2-yl)-2-(furan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 32500831 |
| Molecular Formula | C15H9NO2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-2-(furan-2-yl)-1,3-thiazole |
| SMILES | c1coc(-c2nc(-c3cc4ccccc4o3)cs2)c1 |
| InChI | InChI=1S/C15H9NO2S/c1-2-5-12-10(4-1)8-14(18-12)11-9-19-15(16-11)13-6-3-7-17-13/h1-9H |
| InChIKey | QNTRXSCTSCBUIT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |