C18H14N2OS — CID 20983781
[3-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]phenyl]methanamine (PubChem CID 20983781) has the molecular formula C18H14N2OS and a molecular weight of 306.39 g/mol. Its IUPAC name is [3-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]phenyl]methanamine.
| Compound Name | [3-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 20983781 |
| Molecular Formula | C18H14N2OS |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | [3-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]phenyl]methanamine |
| SMILES | NCc1cccc(-c2nc(-c3cc4ccccc4o3)cs2)c1 |
| InChI | InChI=1S/C18H14N2OS/c19-10-12-4-3-6-14(8-12)18-20-15(11-22-18)17-9-13-5-1-2-7-16(13)21-17/h1-9,11H,10,19H2 |
| InChIKey | ZJIYCVYMXODTPG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |