C17H12N2OS — CID 43667812
4-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]aniline (PubChem CID 43667812) has the molecular formula C17H12N2OS and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]aniline.
| Compound Name | 4-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]aniline |
|---|---|
| PubChem CID | 43667812 |
| Molecular Formula | C17H12N2OS |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]aniline |
| SMILES | Nc1ccc(-c2nc(-c3cc4ccccc4o3)cs2)cc1 |
| InChI | InChI=1S/C17H12N2OS/c18-13-7-5-11(6-8-13)17-19-14(10-21-17)16-9-12-3-1-2-4-15(12)20-16/h1-10H,18H2 |
| InChIKey | KZIANQSKGBARET-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|