C16H11N3S — CID 43667845
4-[2-(4-aminophenyl)-1,3-thiazol-4-yl]benzonitrile (PubChem CID 43667845) has the molecular formula C16H11N3S and a molecular weight of 277.35 g/mol. Its IUPAC name is 4-[2-(4-aminophenyl)-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 4-[2-(4-aminophenyl)-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 43667845 |
| Molecular Formula | C16H11N3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-[2-(4-aminophenyl)-1,3-thiazol-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2csc(-c3ccc(N)cc3)n2)cc1 |
| InChI | InChI=1S/C16H11N3S/c17-9-11-1-3-12(4-2-11)15-10-20-16(19-15)13-5-7-14(18)8-6-13/h1-8,10H,18H2 |
| InChIKey | QTCXFSPWHUGSRT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|