C16H11N3O2S2 — CID 166436069
4-[2-(4-cyanophenyl)-1,3-thiazol-4-yl]benzenesulfonamide (PubChem CID 166436069) has the molecular formula C16H11N3O2S2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 4-[2-(4-cyanophenyl)-1,3-thiazol-4-yl]benzenesulfonamide.
| Compound Name | 4-[2-(4-cyanophenyl)-1,3-thiazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 166436069 |
| Molecular Formula | C16H11N3O2S2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 4-[2-(4-cyanophenyl)-1,3-thiazol-4-yl]benzenesulfonamide |
| SMILES | N#Cc1ccc(-c2nc(-c3ccc(S(N)(=O)=O)cc3)cs2)cc1 |
| InChI | InChI=1S/C16H11N3O2S2/c17-9-11-1-3-13(4-2-11)16-19-15(10-22-16)12-5-7-14(8-6-12)23(18,20)21/h1-8,10H,(H2,18,20,21) |
| InChIKey | UEFNOYARYDEHGB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |