C17H13N3O3S2 — CID 2441401
4-cyano-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzenesulfonamide (PubChem CID 2441401) has the molecular formula C17H13N3O3S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 4-cyano-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 2441401 |
| Molecular Formula | C17H13N3O3S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 4-cyano-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]benzenesulfonamide |
| SMILES | COc1ccc(-c2csc(NS(=O)(=O)c3ccc(C#N)cc3)n2)cc1 |
| InChI | InChI=1S/C17H13N3O3S2/c1-23-14-6-4-13(5-7-14)16-11-24-17(19-16)20-25(21,22)15-8-2-12(10-18)3-9-15/h2-9,11H,1H3,(H,19,20) |
| InChIKey | VEGKAYUGZUOJLH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|