C17H13ClN2O4S2 — CID 154749823
methyl 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfamoyl]benzoate (PubChem CID 154749823) has the molecular formula C17H13ClN2O4S2 and a molecular weight of 408.89 g/mol. Its IUPAC name is methyl 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfamoyl]benzoate.
| Compound Name | methyl 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 154749823 |
| Molecular Formula | C17H13ClN2O4S2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | methyl 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)Nc2nc(-c3ccc(Cl)cc3)cs2)cc1 |
| InChI | InChI=1S/C17H13ClN2O4S2/c1-24-16(21)12-4-8-14(9-5-12)26(22,23)20-17-19-15(10-25-17)11-2-6-13(18)7-3-11/h2-10H,1H3,(H,19,20) |
| InChIKey | GLYPLUZNMCWSSO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|