C17H13FN2O4S2 — CID 95038335
methyl 4-fluoro-3-[(4-phenyl-1,3-thiazol-2-yl)sulfamoyl]benzoate (PubChem CID 95038335) has the molecular formula C17H13FN2O4S2 and a molecular weight of 392.43 g/mol. Its IUPAC name is methyl 4-fluoro-3-[(4-phenyl-1,3-thiazol-2-yl)sulfamoyl]benzoate.
| Compound Name | methyl 4-fluoro-3-[(4-phenyl-1,3-thiazol-2-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 95038335 |
| Molecular Formula | C17H13FN2O4S2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | methyl 4-fluoro-3-[(4-phenyl-1,3-thiazol-2-yl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(F)c(S(=O)(=O)Nc2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C17H13FN2O4S2/c1-24-16(21)12-7-8-13(18)15(9-12)26(22,23)20-17-19-14(10-25-17)11-5-3-2-4-6-11/h2-10H,1H3,(H,19,20) |
| InChIKey | BKQAQDBJLPNCDR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|