C24H18FN3O3S — CID 168579224
methyl 4-fluoro-3-[2-hydroxy-3-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]benzoate (PubChem CID 168579224) has the molecular formula C24H18FN3O3S and a molecular weight of 447.49 g/mol. Its IUPAC name is methyl 4-fluoro-3-[2-hydroxy-3-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]benzoate.
| Compound Name | methyl 4-fluoro-3-[2-hydroxy-3-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 168579224 |
| Molecular Formula | C24H18FN3O3S |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | methyl 4-fluoro-3-[2-hydroxy-3-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]benzoate |
| SMILES | COC(=O)c1ccc(F)c(-c2cccc(C=NNc3nc(-c4ccccc4)cs3)c2O)c1 |
| InChI | InChI=1S/C24H18FN3O3S/c1-31-23(30)16-10-11-20(25)19(12-16)18-9-5-8-17(22(18)29)13-26-28-24-27-21(14-32-24)15-6-3-2-4-7-15/h2-14,29H,1H3,(H,27,28) |
| InChIKey | GWKKJZBZILLJJF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|