C21H20FN3O2S — CID 168577943
tert-butyl 3-fluoro-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate (PubChem CID 168577943) has the molecular formula C21H20FN3O2S and a molecular weight of 397.48 g/mol. Its IUPAC name is tert-butyl 3-fluoro-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate.
| Compound Name | tert-butyl 3-fluoro-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 168577943 |
| Molecular Formula | C21H20FN3O2S |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | tert-butyl 3-fluoro-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(C=NNc2nc(-c3ccccc3)cs2)c(F)c1 |
| InChI | InChI=1S/C21H20FN3O2S/c1-21(2,3)27-19(26)15-9-10-16(17(22)11-15)12-23-25-20-24-18(13-28-20)14-7-5-4-6-8-14/h4-13H,1-3H3,(H,24,25) |
| InChIKey | QYPRQARRJHZJRF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|