C20H19FN4S — CID 168576719
N-[(2-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 168576719) has the molecular formula C20H19FN4S and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[(2-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[(2-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168576719 |
| Molecular Formula | C20H19FN4S |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | N-[(2-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | Fc1cc(N2CCCC2)ccc1C=NNc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C20H19FN4S/c21-18-12-17(25-10-4-5-11-25)9-8-16(18)13-22-24-20-23-19(14-26-20)15-6-2-1-3-7-15/h1-3,6-9,12-14H,4-5,10-11H2,(H,23,24) |
| InChIKey | ZXPRCBYBEUFOPN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|