C20H19F2N3OS — CID 168577219
N-[(2-butoxy-3,5-difluorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 168577219) has the molecular formula C20H19F2N3OS and a molecular weight of 387.46 g/mol. Its IUPAC name is N-[(2-butoxy-3,5-difluorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[(2-butoxy-3,5-difluorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168577219 |
| Molecular Formula | C20H19F2N3OS |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-[(2-butoxy-3,5-difluorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | CCCCOc1c(F)cc(F)cc1C=NNc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C20H19F2N3OS/c1-2-3-9-26-19-15(10-16(21)11-17(19)22)12-23-25-20-24-18(13-27-20)14-7-5-4-6-8-14/h4-8,10-13H,2-3,9H2,1H3,(H,24,25) |
| InChIKey | RPEWTJRNDNQERF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|