C16H20F2N4OS — CID 168626009
2-N-[(3,5-difluoro-2-hexoxyphenyl)methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168626009) has the molecular formula C16H20F2N4OS and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-N-[(3,5-difluoro-2-hexoxyphenyl)methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[(3,5-difluoro-2-hexoxyphenyl)methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168626009 |
| Molecular Formula | C16H20F2N4OS |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-N-[(3,5-difluoro-2-hexoxyphenyl)methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | CCCCCCOc1c(F)cc(F)cc1C=NNc1nc(N)cs1 |
| InChI | InChI=1S/C16H20F2N4OS/c1-2-3-4-5-6-23-15-11(7-12(17)8-13(15)18)9-20-22-16-21-14(19)10-24-16/h7-10H,2-6,19H2,1H3,(H,21,22) |
| InChIKey | QGRDLBVAYXPZNZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|