C15H16Br2N4O2S — CID 168627563
2-N-[(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168627563) has the molecular formula C15H16Br2N4O2S and a molecular weight of 476.19 g/mol. Its IUPAC name is 2-N-[(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168627563 |
| Molecular Formula | C15H16Br2N4O2S |
| Molecular Weight | 476.19 g/mol |
| Exact Mass | 473.94 |
| IUPAC Name | 2-N-[(2,3-dibromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | C=CCOc1c(OCC)cc(C=NNc2nc(N)cs2)c(Br)c1Br |
| InChI | InChI=1S/C15H16Br2N4O2S/c1-3-5-23-14-10(22-4-2)6-9(12(16)13(14)17)7-19-21-15-20-11(18)8-24-15/h3,6-8H,1,4-5,18H2,2H3,(H,20,21) |
| InChIKey | IXKQTCLIOIBIDC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.19 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|